RARECHEM AL BF 0916

RARECHEM AL BF 0916 - Names and Identifiers

Name	Methyl 2-bromo-4-methylbenzoate
Synonyms	RARECHEM AL BF 0916 2-bromo-4-methylbenzoate Methyl2-Bromo-4-Methylbenzoat Methyl 2-bromo-4-methylbenzoate METHYL 2-BROMO-4-METHYLBENZOATE benzoic acid, 2-bromo-4-methyl-, methyl ester Benzoic acid, 2-bromo-4-methyl-, methyl ester
CAS	87808-49-9
InChI	InChI=1/C9H9BrO2/c1-6-3-4-7(8(10)5-6)9(11)12-2/h3-5H,1-2H3

RARECHEM AL BF 0916 - Physico-chemical Properties

Molecular Formula	C9H9BrO2
Molar Mass	229.07
Density	1.433±0.06 g/cm3(Predicted)
Boling Point	161-164 °C(Press: 32 Torr)
Flash Point	113.962°C
Vapor Presure	0.009mmHg at 25°C
Appearance	Solid
Storage Condition	Sealed in dry,Room Temperature
Refractive Index	1.545

RARECHEM AL BF 0916 - Introduction

Methyl 2-bromo-4-methylbenzoate is an organic compound with the chemical formula C9H9BrO2 and its properties are as follows:

1. Appearance: Methyl 2-bromo-4-methylbenzoate is a colorless to slightly yellow liquid.
2. melting point: about 20-22 degrees Celsius.
3. Boiling point: about 250 degrees Celsius.
4. density: 1.438g/cm³.
5. Solubility: Methyl 2-bromo-4-methylbenzoate is soluble in organic solvents, such as ether, alcohol, chloroform, etc.

The main uses of Methyl 2-bromo-4-methylbenzoate include:

1. Chemical synthesis: As an important intermediate in organic synthesis, it can be used to synthesize other compounds.
2. pesticide preparation: can be used to synthesize some pesticides, such as pesticides.

Methyl 2-bromo-4-methylbenzoate is generally prepared by the following steps:

1. under appropriate conditions, will

Last Update：2024-04-10 22:29:15